1-Piperidineacetamide, a-(4-methoxyphenyl)- structure
|
Common Name | 1-Piperidineacetamide, a-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 74467-62-2 | Molecular Weight | 248.32100 | |
| Density | 1.139g/cm3 | Boiling Point | 404.8ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.6ºC | |
| Name | 2-(4-methoxyphenyl)-2-piperidin-1-ylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 404.8ºC at 760 mmHg |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.32100 |
| Flash Point | 198.6ºC |
| Exact Mass | 248.15200 |
| PSA | 55.56000 |
| LogP | 2.34570 |
| Index of Refraction | 1.562 |
| InChIKey | SEOIQQZRZTXYIL-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C(N)=O)N2CCCCC2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-Methoxyphenyl)-2-(1-piperidinyl)acetamide |
| (4-Methoxy-phenyl)-piperidino-essigsaeure-amid |
| (4-methoxy-phenyl)-piperidino-acetic acid amide |
| 2-(4-methoxyphenyl)-2-piperidinoacetamide |
| 2-(4-methoxyphenyl)-2-(piperidin-1-yl)acetamide |