1,3-dimethyl-1,1,3,3-tetraphenyldisilazane structure
|
Common Name | 1,3-dimethyl-1,1,3,3-tetraphenyldisilazane | ||
|---|---|---|---|---|
| CAS Number | 7453-26-1 | Molecular Weight | 409.670 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 458.8±18.0 °C at 760 mmHg | |
| Molecular Formula | C26H27NSi2 | Melting Point | 87-89ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 231.3±21.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,3-dimethyl-1,1,3,3-tetraphenyldisilazane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 458.8±18.0 °C at 760 mmHg |
| Melting Point | 87-89ºC(lit.) |
| Molecular Formula | C26H27NSi2 |
| Molecular Weight | 409.670 |
| Flash Point | 231.3±21.2 °C |
| Exact Mass | 409.168213 |
| PSA | 12.03000 |
| LogP | 9.33 |
| Appearance of Characters | solid |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | YFONAHAKNVIHPT-UHFFFAOYSA-N |
| SMILES | C[Si](N[Si](C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~58%
1,3-dimethyl-1,... CAS#:7453-26-1 |
| Literature: Sevast'yanova, I. V.; Klebanskii, A. L.; Timofeeva, T. N.; Ponomarev, A. I. J. Gen. Chem. USSR (Engl. Transl.), 1980 , vol. 50, # 10 p. 2279 - 2283,1844 - 1847 |
|
Concentration modulation by thermal decomposition for multiplex gas chromatography.
HRC CC J. High Resolut. Chromatogr. Chromatogr. Commun. 8 , 718, (1985)
|
| Silanamine, 1-methyl-N-(methyldiphenylsilyl)-1,1-diphenyl- |
| Bis(methyldiphenylsilyl)amine |
| 1,1,3,3-TETRAPHENYL-1,3-DIMETHYLDISILAZANE |
| EINECS 231-227-5 |
| 1-Methyl-N-[methyl(diphenyl)silyl]-1,1-diphenylsilanamine |
| TPDMDS |
| N,N-Bis-(diphenylmethyl-silyl)-amin |
| 1,3-Dimethyl-1,1,3,3-tetraphenylpropanedisilazane |
| 1-methyl-N-(methyldiphenylsilyl)-1,1-diphenylsilylamine |
| 1,1,3,3-TETRAPHENYLDIMETHYLDISILAZANE |
| 1,3-Dimethyl-1,1,3,3-tetraphenyl-disilazan |
| 1,1,3,3-Tetraphenyl-1,3-dimethylpropanedisilazane |
| MFCD00042831 |
| Di(diphenylmethylsilyl)amin |