4-(3-oxo-3-phenyl-propenyl)-benzenesulfonyl chloride structure
|
Common Name | 4-(3-oxo-3-phenyl-propenyl)-benzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 7454-09-3 | Molecular Weight | 306.76400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-oxo-3-phenyl-propenyl)-benzenesulfonyl chloride |
|---|
| Molecular Formula | C15H11ClO3S |
|---|---|
| Molecular Weight | 306.76400 |
| Exact Mass | 306.01200 |
| PSA | 59.59000 |
| LogP | 4.59100 |
| InChIKey | QJOPDPKVYXDCAE-DHZHZOJOSA-N |
| SMILES | O=C(C=Cc1ccc(S(=O)(=O)Cl)cc1)c1ccccc1 |
|
~75%
4-(3-oxo-3-phen... CAS#:7454-09-3 |
| Literature: El-Sayed, Ragab A. Phosphorus, Sulfur and Silicon and the Related Elements, 2007 , vol. 182, # 5 p. 1143 - 1151 |