Triethyl 1,1,2-ethanetricarboxylate structure
|
Common Name | Triethyl 1,1,2-ethanetricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 7459-46-3 | Molecular Weight | 246.257 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 300.7±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H18O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 127.4±22.4 °C | |
| Name | Triethyl 1,1,2-Ethanetricarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 300.7±22.0 °C at 760 mmHg |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.257 |
| Flash Point | 127.4±22.4 °C |
| Exact Mass | 246.110336 |
| PSA | 78.90000 |
| LogP | 1.67 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.441 |
| InChIKey | TVWZLLYAJDSSCJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C(=O)OCC)C(=O)OCC |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Safety Phrases | S23-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917190090 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| triethyl ethane-1,1,2-tricarboxylate |
| Ethane-1,1,2-tricarboxylic acid, triethyl ester |
| Triethyl ethane-1,2,2-tricarboxylate |
| EINECS 231-235-9 |
| MFCD00009154 |
| 1,1,2-Ethanetricarboxylic acid, triethyl ester |
| Triethyl 1,1,2-ethanetricarboxylate |