[1,1'-Biphenyl]-2,2',5,5'-tetrol,4,4'-dimethoxy-, 2,2',5,5'-tetraacetate structure
|
Common Name | [1,1'-Biphenyl]-2,2',5,5'-tetrol,4,4'-dimethoxy-, 2,2',5,5'-tetraacetate | ||
|---|---|---|---|---|
| CAS Number | 7461-72-5 | Molecular Weight | 446.40400 | |
| Density | 1.263g/cm3 | Boiling Point | 562.5ºC at 760 mmHg | |
| Molecular Formula | C22H22O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.8ºC | |
| Name | [4-acetyloxy-2-(2,5-diacetyloxy-4-methoxyphenyl)-5-methoxyphenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 562.5ºC at 760 mmHg |
| Molecular Formula | C22H22O10 |
| Molecular Weight | 446.40400 |
| Flash Point | 242.8ºC |
| Exact Mass | 446.12100 |
| PSA | 123.66000 |
| LogP | 3.07200 |
| Index of Refraction | 1.532 |
| InChIKey | QBGAHSSWDUWJMX-UHFFFAOYSA-N |
| SMILES | COc1cc(OC(C)=O)c(-c2cc(OC(C)=O)c(OC)cc2OC(C)=O)cc1OC(C)=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (4,4'-Dimethoxy-biphenyltetrayl-(2,5,2',5'))-tetraacetat |
| 2,5,2',5'-Tetraacetoxy-4,4'-dimethoxy-biphenyl |