8-amino-3-butyl-1,7-dimethyl-purine-2,6-dione structure
|
Common Name | 8-amino-3-butyl-1,7-dimethyl-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 7464-85-9 | Molecular Weight | 251.28500 | |
| Density | 1.4g/cm3 | Boiling Point | 469.5ºC at 760 mmHg | |
| Molecular Formula | C11H17N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.8ºC | |
| Name | 8-amino-3-butyl-1,7-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 469.5ºC at 760 mmHg |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.28500 |
| Flash Point | 237.8ºC |
| Exact Mass | 251.13800 |
| PSA | 87.84000 |
| LogP | 0.39720 |
| Index of Refraction | 1.662 |
| InChIKey | DMQOLEPZUYDGIF-UHFFFAOYSA-N |
| SMILES | CCCCn1c(=O)n(C)c(=O)c2c1nc(N)n2C |
|
~%
8-amino-3-butyl... CAS#:7464-85-9 |
| Literature: Blicke; Godt Journal of the American Chemical Society, 1954 , vol. 76, p. 3655 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 8-amino-3-butyl-1,7-dimethyl-3,7-dihydro-purine-2,6-dione |
| 8-Amino-3-butyl-1,7-dimethyl-3,7-dihydro-purin-2,6-dion |