Decanedioic acid,4,7-bis(3-methoxy-3-oxopropyl)-4,7-dinitro-, 1,10-dimethyl ester structure
|
Common Name | Decanedioic acid,4,7-bis(3-methoxy-3-oxopropyl)-4,7-dinitro-, 1,10-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7465-52-3 | Molecular Weight | 492.47400 | |
| Density | 1.236g/cm3 | Boiling Point | 457ºC at 760mmHg | |
| Molecular Formula | C20H32N2O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.8ºC | |
| Name | dimethyl 4,7-bis(3-methoxy-3-oxopropyl)-4,7-dinitrodecanedioate |
|---|
| Density | 1.236g/cm3 |
|---|---|
| Boiling Point | 457ºC at 760mmHg |
| Molecular Formula | C20H32N2O12 |
| Molecular Weight | 492.47400 |
| Flash Point | 129.8ºC |
| Exact Mass | 492.19600 |
| PSA | 196.84000 |
| LogP | 2.65680 |
| Index of Refraction | 1.483 |
| InChIKey | ROBBWICTEIZDHS-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(CCC(=O)OC)(CCC(CCC(=O)OC)(CCC(=O)OC)[N+](=O)[O-])[N+](=O)[O-] |
|
~%
Decanedioic aci... CAS#:7465-52-3 |
| Literature: Feuer,H.; Harmetz,R. Journal of Organic Chemistry, 1961 , vol. 26, p. 1061 - 1072 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|