Benzamide,4-methoxy-N-(phenylmethyl)
Benzamide,4-methoxy-N-(phenylmethyl) structure
|
Common Name | Benzamide,4-methoxy-N-(phenylmethyl) | ||
|---|---|---|---|---|
| CAS Number | 7465-87-4 | Molecular Weight | 241.28500 | |
| Density | 1.124g/cm3 | Boiling Point | 441.2ºC at 760mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-benzyl-4-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 441.2ºC at 760mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 220.6ºC |
| Exact Mass | 241.11000 |
| PSA | 38.33000 |
| LogP | 3.01610 |
| Index of Refraction | 1.576 |
| InChIKey | GEFZSLMGZREDTO-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)NCc2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 7 | |
CAS#:100-09-4
CAS#:100-46-9
CAS#:623-12-1
CAS#:201230-82-2
CAS#:622-79-7
CAS#:100-07-2
CAS#:696-62-8
CAS#:3287-99-8
CAS#:123-11-5
CAS#:105-13-5
CAS#:3424-93-9
CAS#:619-57-8
CAS#:100-52-7
CAS#:14429-02-8
CAS#:874-90-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-methoxy-N-benzylbenzamide |
| N-benzyl-p-anisamide |
| N-benzyl-4-methoxylbenzamide |
| N-benzyl 4-methoxybenzamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-benzyl-4-methoxybenzamide? |
| A: Molecular formula of N-benzyl-4-methoxybenzamide is C15H15NO2. |
| Q: What is the Chinese name of 7465-87-4? |
| A: Chinese name of 7465-87-4 is 7465-87-4. |
| Q: What is the LogP of N-benzyl-4-methoxybenzamide? |
| A: LogP of N-benzyl-4-methoxybenzamide is 3.01610. |
| Q: What is the InChIKey of N-benzyl-4-methoxybenzamide? |
| A: InChIKey of N-benzyl-4-methoxybenzamide is GEFZSLMGZREDTO-UHFFFAOYSA-N. |
| Q: What is the boiling point of N-benzyl-4-methoxybenzamide? |
| A: Boiling point of N-benzyl-4-methoxybenzamide is 441.2ºC at 760mmHg. |
| Q: What is the SMILES notation of N-benzyl-4-methoxybenzamide? |
| A: SMILES notation of N-benzyl-4-methoxybenzamide is COc1ccc(C(=O)NCc2ccccc2)cc1. |
| Q: What is the CAS number of N-benzyl-4-methoxybenzamide? |
| A: CAS number of N-benzyl-4-methoxybenzamide is 7465-87-4. |
| Q: What English synonyms does N-benzyl-4-methoxybenzamide have? |
| A: English synonyms of N-benzyl-4-methoxybenzamide: 4-methoxy-N-benzylbenzamide, N-benzyl-p-anisamide, N-benzyl-4-methoxylbenzamide, N-benzyl 4-methoxybenzamide. |
| Q: What are the upstream materials of N-benzyl-4-methoxybenzamide? |
| A: Related upstream materials(CAS) of N-benzyl-4-methoxybenzamide: 100-09-4;100-46-9;623-12-1;201230-82-2;622-79-7;100-07-2;696-62-8;3287-99-8;123-11-5. |
| Q: What is the molecular weight of N-benzyl-4-methoxybenzamide? |
| A: Molecular weight of N-benzyl-4-methoxybenzamide is 241.28500. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |