(3-fluorophenyl)-(3,4,5-trifluorophenyl)methanone structure
|
Common Name | (3-fluorophenyl)-(3,4,5-trifluorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 746651-92-3 | Molecular Weight | 254.18000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H6F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-fluorophenyl)-(3,4,5-trifluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H6F4O |
|---|---|
| Molecular Weight | 254.18000 |
| Exact Mass | 254.03500 |
| PSA | 17.07000 |
| LogP | 3.47400 |
| InChIKey | HOUGDIGMWHMSBC-UHFFFAOYSA-N |
| SMILES | O=C(c1cccc(F)c1)c1cc(F)c(F)c(F)c1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3,3',4,5-Tetrafluorobenzophenone |