4-CHLORO-3',4',5'-TRIFLUOROBENZOPHENONE structure
|
Common Name | 4-CHLORO-3',4',5'-TRIFLUOROBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 746651-96-7 | Molecular Weight | 270.63400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H6ClF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-chlorophenyl)-(3,4,5-trifluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H6ClF3O |
|---|---|
| Molecular Weight | 270.63400 |
| Exact Mass | 270.00600 |
| PSA | 17.07000 |
| LogP | 3.98830 |
| InChIKey | HSAXKZYYPDQFHA-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)c1cc(F)c(F)c(F)c1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Chloro-3',4',5'-trifluorobenzophenone |