9H-Purine-2,8-diamine,N2,N8-bis(2-furanylmethyl)-6-(4-morpholinyl)- structure
|
Common Name | 9H-Purine-2,8-diamine,N2,N8-bis(2-furanylmethyl)-6-(4-morpholinyl)- | ||
|---|---|---|---|---|
| CAS Number | 7469-10-5 | Molecular Weight | 395.41500 | |
| Density | 1.46g/cm3 | Boiling Point | 693ºC at 760mmHg | |
| Molecular Formula | C19H21N7O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 372.9ºC | |
| Name | 2-N,8-N-bis(furan-2-ylmethyl)-6-morpholin-4-yl-7H-purine-2,8-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 693ºC at 760mmHg |
| Molecular Formula | C19H21N7O3 |
| Molecular Weight | 395.41500 |
| Flash Point | 372.9ºC |
| Exact Mass | 395.17100 |
| PSA | 117.27000 |
| LogP | 2.81070 |
| Index of Refraction | 1.724 |
| InChIKey | SHCJCDVVMUEWBC-UHFFFAOYSA-N |
| SMILES | c1coc(CNc2nc(N3CCOCC3)c3[nH]c(NCc4ccco4)nc3n2)c1 |
|
~%
9H-Purine-2,8-d... CAS#:7469-10-5 |
| Literature: Breshears et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3789,3790 |
|
~%
9H-Purine-2,8-d... CAS#:7469-10-5 |
| Literature: Breshears et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3789,3790 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N2,N8-Difurfuryl-6-morpholino-7(9)H-purin-2,8-diyldiamin |
| N2,N8-difurfuryl-6-morpholino-7(9)H-purine-2,8-diyldiamine |