2,8-dichloro-6-morpholin-4-yl-7H-purine structure
|
Common Name | 2,8-dichloro-6-morpholin-4-yl-7H-purine | ||
|---|---|---|---|---|
| CAS Number | 4010-79-1 | Molecular Weight | 274.10700 | |
| Density | 1.624g/cm3 | Boiling Point | 479.1ºC at 760 mmHg | |
| Molecular Formula | C9H9Cl2N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.5ºC | |
| Name | 4-(2,8-dichloro-7H-purin-6-yl)morpholine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.624g/cm3 |
|---|---|
| Boiling Point | 479.1ºC at 760 mmHg |
| Molecular Formula | C9H9Cl2N5O |
| Molecular Weight | 274.10700 |
| Flash Point | 243.5ºC |
| Exact Mass | 273.01800 |
| PSA | 66.93000 |
| LogP | 1.56130 |
| Vapour Pressure | 2.44E-09mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | CTUKDTNJKHIPJZ-UHFFFAOYSA-N |
| SMILES | Clc1nc(N2CCOCC2)c2[nH]c(Cl)nc2n1 |
| HS Code | 2934999090 |
|---|
|
~%
2,8-dichloro-6-... CAS#:4010-79-1 |
| Literature: Breshears et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3789,3790 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Morpholino-2,8-dichlorpurin |