[6-(1-piperidyl)-5H-purin-2-yl]hydrazine structure
|
Common Name | [6-(1-piperidyl)-5H-purin-2-yl]hydrazine | ||
|---|---|---|---|---|
| CAS Number | 7469-13-8 | Molecular Weight | 233.27300 | |
| Density | 1.67g/cm3 | Boiling Point | 392.8ºC at 760 mmHg | |
| Molecular Formula | C10H15N7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.4ºC | |
| Name | (6-piperidin-1-yl-7H-purin-2-yl)hydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 392.8ºC at 760 mmHg |
| Molecular Formula | C10H15N7 |
| Molecular Weight | 233.27300 |
| Flash Point | 191.4ºC |
| Exact Mass | 233.13900 |
| PSA | 98.98000 |
| LogP | 0.81600 |
| Index of Refraction | 1.848 |
| InChIKey | DHTNBNNYSAPEKI-UHFFFAOYSA-N |
| SMILES | NNc1nc(N2CCCCC2)c2[nH]cnc2n1 |
|
~%
[6-(1-piperidyl... CAS#:7469-13-8 |
| Literature: Breshears et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3789,3790 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-hydrazino-6-piperidin-1-yl-7H-purine |