2-(benzylsulfonylamino)-4-methylsulfanyl-butanoic acid structure
|
Common Name | 2-(benzylsulfonylamino)-4-methylsulfanyl-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 7469-26-3 | Molecular Weight | 303.39800 | |
| Density | 1.335g/cm3 | Boiling Point | 526ºC at 760 mmHg | |
| Molecular Formula | C12H17NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.9ºC | |
| Name | 2-(benzylsulfonylamino)-4-methylsulfanylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 526ºC at 760 mmHg |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.39800 |
| Flash Point | 271.9ºC |
| Exact Mass | 303.06000 |
| PSA | 117.15000 |
| LogP | 2.78400 |
| Index of Refraction | 1.59 |
| InChIKey | LQNRCCPDNDTDSZ-UHFFFAOYSA-N |
| SMILES | CSCCC(NS(=O)(=O)Cc1ccccc1)C(=O)O |
|
~%
2-(benzylsulfon... CAS#:7469-26-3 |
| Literature: Milne; Peng Journal of the American Chemical Society, 1957 , vol. 79, p. 639,642 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| N-phenylmethanesulfonyl-DL-methionine-(N'-phenyl-hydrazide) |
| N-phenylmethanesulfonyl-D-methionine |
| N-Phenylmethansulfonyl-D-methionin |
| N-Phenylmethansulfonyl-DL-methionin-(N'-phenyl-hydrazid) |
| N-[1-(anilinocarbamoyl)-3-methylsulfanyl-propyl]-1-phenyl-methanesulfo namide |