(NZ)-N-[1,2-bis(2-methoxyphenyl)ethylidene]hydroxylamine structure
|
Common Name | (NZ)-N-[1,2-bis(2-methoxyphenyl)ethylidene]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 7469-47-8 | Molecular Weight | 271.31100 | |
| Density | 1.101g/cm3 | Boiling Point | 443.155ºC at 760 mmHg | |
| Molecular Formula | C16H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.813ºC | |
| Name | (NZ)-N-[1,2-bis(2-methoxyphenyl)ethylidene]hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.101g/cm3 |
|---|---|
| Boiling Point | 443.155ºC at 760 mmHg |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.31100 |
| Flash Point | 221.813ºC |
| Exact Mass | 271.12100 |
| PSA | 51.05000 |
| LogP | 3.12480 |
| Index of Refraction | 1.542 |
| InChIKey | IIWBETKTHMPMSB-VKAVYKQESA-N |
| SMILES | COc1ccccc1CC(=NO)c1ccccc1OC |
|
~%
(NZ)-N-[1,2-bis... CAS#:7469-47-8 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1945 , vol. 67, p. 1606 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,2'-dimethoxy-deoxybenzoin oxime |
| 2,2'-Dimethoxy-desoxybenzoin-oxim |