Ethanone,1-(4-methoxyphenyl)-2-(2-quinolinyl)- structure
|
Common Name | Ethanone,1-(4-methoxyphenyl)-2-(2-quinolinyl)- | ||
|---|---|---|---|---|
| CAS Number | 7469-86-5 | Molecular Weight | 277.31700 | |
| Density | 1.19g/cm3 | Boiling Point | 464ºC at 760 mmHg | |
| Molecular Formula | C18H15NO2 | Melting Point | 194-196ºC | |
| MSDS | N/A | Flash Point | 234.4ºC | |
| Name | 1-(4-Methoxyphenyl)-2-quinolin-2-ylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 464ºC at 760 mmHg |
| Melting Point | 194-196ºC |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.31700 |
| Flash Point | 234.4ºC |
| Exact Mass | 277.11000 |
| PSA | 39.19000 |
| LogP | 3.66880 |
| Index of Refraction | 1.634 |
| InChIKey | XEXQEYGNRKJASK-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Cc2ccc3ccccc3n2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
|
~78%
Ethanone,1-(4-m... CAS#:7469-86-5 |
| Literature: Wang, Tianli; Ouyang, Guanghui; He, Yan-Mei; Fan, Qing-Hua Synlett, 2011 , # 7 p. 939 - 942 |
|
~%
Ethanone,1-(4-m... CAS#:7469-86-5 |
| Literature: Bergstrom; Moffat Journal of the American Chemical Society, 1937 , vol. 59, p. 1494,1496 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-Methoxyphenyl)-2-(quinolin-2-yl)ethan-1-one |
| 2-p-methoxy-phenacyl-quinoline,p-methoxyphenyl quinolylketone |
| 1-(4-methoxy-phenyl)-2-quinolin-2-yl-ethanone |
| 2-[2]Chinolyl-1-(4-methoxy-phenyl)-aethanon |
| 2-[2]quinolyl-1-(4-methoxy-phenyl)-ethanone |