ethyl 4-benzoyloxybenzoate structure
|
Common Name | ethyl 4-benzoyloxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 7471-31-0 | Molecular Weight | 270.28000 | |
| Density | 1.189g/cm3 | Boiling Point | 401.6ºC at 760 mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.3ºC | |
| Name | ethyl 4-benzoyloxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 401.6ºC at 760 mmHg |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28000 |
| Flash Point | 201.3ºC |
| Exact Mass | 270.08900 |
| PSA | 52.60000 |
| LogP | 3.08250 |
| Index of Refraction | 1.567 |
| InChIKey | OYLFFADWNSJZBV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(OC(=O)c2ccccc2)cc1 |
|
~%
ethyl 4-benzoyl... CAS#:7471-31-0 |
| Literature: Shah; Shah Journal of the University of Bombay, Science: Physical Sciences, Mathematics, Biological Sciences and Medicine, 1949 , vol. 18/3 A, p. 25,27 |
| 4-Benzoyloxy-benzoesaeure-aethylester |
| 4-ethoxycarbonylphenyl benzoate |
| ethyl 4-(benzoyloxy)benzoate |
| Benzoesaeure-<4-aethoxycarbonyl-phenyl-ester> |
| 4-benzoyloxy-benzoic acid ethyl ester |
| 4-Aethylphenylcarboxylat-benzoat |