methyl 6-methoxy-2-methyl-1-oxo-3,4-dihydrophenanthrene-2-carboxylate structure
|
Common Name | methyl 6-methoxy-2-methyl-1-oxo-3,4-dihydrophenanthrene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 7471-38-7 | Molecular Weight | 298.33300 | |
| Density | 1.208g/cm3 | Boiling Point | 449.4ºC at 760 mmHg | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199ºC | |
| Name | methyl 6-methoxy-2-methyl-1-oxo-3,4-dihydrophenanthrene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.208g/cm3 |
|---|---|
| Boiling Point | 449.4ºC at 760 mmHg |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.33300 |
| Flash Point | 199ºC |
| Exact Mass | 298.12100 |
| PSA | 52.60000 |
| LogP | 3.15660 |
| Index of Refraction | 1.589 |
| InChIKey | IKBFNACKPKWCCC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(C)CCc2c(ccc3ccc(OC)cc23)C1=O |
|
~%
methyl 6-methox... CAS#:7471-38-7 |
| Literature: Bachmann; Horton Journal of the American Chemical Society, 1947 , vol. 69, p. 58,59 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 6-methoxy-2-methyl-1-oxo-1,2,3,4-tetrahydro-phenanthrene-2-carboxylic acid methyl ester |
| 6-Methoxy-2-methyl-1-oxo-1,2,3,4-tetrahydro-phenanthren-2-carbonsaeure-methylester |