1-Phenanthreneaceticacid, 2-carboxy-1,2,3,4-tetrahydro-6-methoxy-2-methyl- structure
|
Common Name | 1-Phenanthreneaceticacid, 2-carboxy-1,2,3,4-tetrahydro-6-methoxy-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 7471-40-1 | Molecular Weight | 328.35900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(carboxymethyl)-6-methoxy-2-methyl-3,4-dihydro-1H-phenanthrene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H20O5 |
|---|---|
| Molecular Weight | 328.35900 |
| Exact Mass | 328.13100 |
| PSA | 83.83000 |
| LogP | 3.44380 |
| InChIKey | WZIUXMJKMACZBB-UHFFFAOYSA-N |
| SMILES | COc1ccc2ccc3c(c2c1)CCC(C)(C(=O)O)C3CC(=O)O |
|
~%
1-Phenanthrenea... CAS#:7471-40-1 |
| Literature: Bachmann; Horton Journal of the American Chemical Society, 1947 , vol. 69, p. 58,59 |
|
~%
1-Phenanthrenea... CAS#:7471-40-1 |
| Literature: Bachmann; Horton Journal of the American Chemical Society, 1947 , vol. 69, p. 58,59 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-carboxymethyl-4-chlorobenzic acid |
| 4-chlorohomophthalic acid |
| 5-Chlorhomophthalsaeure |