5-PHENYL-2-(4-PYRIDYL)OXAZOLE structure
|
Common Name | 5-PHENYL-2-(4-PYRIDYL)OXAZOLE | ||
|---|---|---|---|---|
| CAS Number | 74718-16-4 | Molecular Weight | 222.24200 | |
| Density | 1.174g/cm3 | Boiling Point | 421.3ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.9ºC | |
| Name | 5-phenyl-2-pyridin-4-yl-1,3-oxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 421.3ºC at 760 mmHg |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.24200 |
| Flash Point | 213.9ºC |
| Exact Mass | 222.07900 |
| PSA | 38.92000 |
| LogP | 3.40360 |
| Index of Refraction | 1.59 |
| InChIKey | HGEXVTDKVHLPRZ-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2cnc(-c3ccncc3)o2)cc1 |
| HS Code | 2934999090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Cell survival assay for modulators of telomere damage signalling
Source: 15378
Target: N/A
External Id: TELO_02
|
|
Name: Identification of CBX7 inhibitors - Primary Alpha Screen
Source: 15290
Target: N/A
External Id: CBX7-Alpha-primary
|
| 5-Phenyl-2-(4-pyridyl)oxazole |
| 5-phenyl-2-(pyridin-4-yl)-oxazole |
| 4(5-phenyl-2-oxazolyl)pyridine |
| 4-PyPo |
| MFCD00009784 |
| 4-(5-phenyl-oxazol-2-yl)-pyridine |
| 2-(4-pyridyl)-5-phenyl-oxazole |