Benzeneacetamide, a-methoxy-N-phenyl- structure
|
Common Name | Benzeneacetamide, a-methoxy-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 7472-78-8 | Molecular Weight | 241.28500 | |
| Density | 1.166g/cm3 | Boiling Point | 422.8ºC at 760mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.5ºC | |
| Name | 2-methoxy-N,2-diphenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 422.8ºC at 760mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 209.5ºC |
| Exact Mass | 241.11000 |
| PSA | 38.33000 |
| LogP | 3.08580 |
| Index of Refraction | 1.606 |
| InChIKey | UIIYKLVQLNETKG-UHFFFAOYSA-N |
| SMILES | COC(C(=O)Nc1ccccc1)c1ccccc1 |
|
~80%
Benzeneacetamid... CAS#:7472-78-8 |
| Literature: Maki, Toshikatsu; Ishihara, Kazuaki; Yamamoto, Hisashi Tetrahedron, 2007 , vol. 63, # 35 p. 8645 - 8657 |
|
~%
Benzeneacetamid... CAS#:7472-78-8 |
| Literature: Prager, Rolf H.; Smith, Jason A. Australian Journal of Chemistry, 1995 , vol. 48, # 2 p. 217 - 226 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-methoxy-N-phenyl-2-phenylacetamide |