7-dimethylsulfamoylxanthone-2-carboxylic acid structure
|
Common Name | 7-dimethylsulfamoylxanthone-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 74733-76-9 | Molecular Weight | 347.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(dimethylsulfamoyl)-9-oxoxanthene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13NO6S |
|---|---|
| Molecular Weight | 347.34300 |
| Exact Mass | 347.04600 |
| PSA | 113.27000 |
| LogP | 2.97550 |
| InChIKey | KOODOTIAJCOLNB-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)c1ccc2oc3ccc(C(=O)O)cc3c(=O)c2c1 |
| HS Code | 2935009090 |
|---|
|
~%
7-dimethylsulfa... CAS#:74733-76-9 |
| Literature: Pfister; Wymann; Mahoney; Waterbury Journal of Medicinal Chemistry, 1980 , vol. 23, # 11 p. 1264 - 1267 |
|
~%
7-dimethylsulfa... CAS#:74733-76-9 |
| Literature: Pfister; Wymann; Mahoney; Waterbury Journal of Medicinal Chemistry, 1980 , vol. 23, # 11 p. 1264 - 1267 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 7-Dsxca |
| 7-Dimethylsulfamoylxanthone-2-carboxylic acid |