xanthone-2-carboxylic acid structure
|
Common Name | xanthone-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 40274-67-7 | Molecular Weight | 240.21100 | |
| Density | 1.445g/cm3 | Boiling Point | 483.6ºC at 760 mmHg | |
| Molecular Formula | C14H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.9ºC | |
| Name | 9-Oxoxanthene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.445g/cm3 |
|---|---|
| Boiling Point | 483.6ºC at 760 mmHg |
| Molecular Formula | C14H8O4 |
| Molecular Weight | 240.21100 |
| Flash Point | 192.9ºC |
| Exact Mass | 240.04200 |
| PSA | 67.51000 |
| LogP | 2.64440 |
| Index of Refraction | 1.675 |
| InChIKey | JNPRWSKMJDGYAN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2oc3ccccc3c(=O)c2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-Oxo-xanthen-2-carbonsaeure |
| Xanthone-2-carboxylic acid |
| 9-oxo-xanthene-2-carboxylic acid |
| 9-Oxo-9H-xanthene-2-carboxylic acid |