1-Pentanone,2-hydroxy-1,2,3-triphenyl- structure
|
Common Name | 1-Pentanone,2-hydroxy-1,2,3-triphenyl- | ||
|---|---|---|---|---|
| CAS Number | 7476-13-3 | Molecular Weight | 330.42000 | |
| Density | 1.135g/cm3 | Boiling Point | 484ºC at 760 mmHg | |
| Molecular Formula | C23H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.5ºC | |
| Name | 2-hydroxy-1,2,3-triphenylpentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.135g/cm3 |
|---|---|
| Boiling Point | 484ºC at 760 mmHg |
| Molecular Formula | C23H22O2 |
| Molecular Weight | 330.42000 |
| Flash Point | 205.5ºC |
| Exact Mass | 330.16200 |
| PSA | 37.30000 |
| LogP | 4.95090 |
| Index of Refraction | 1.605 |
| InChIKey | KMTGSLWZBTTYDP-UHFFFAOYSA-N |
| SMILES | CCC(c1ccccc1)C(O)(C(=O)c1ccccc1)c1ccccc1 |
|
~%
1-Pentanone,2-h... CAS#:7476-13-3 |
| Literature: Kohler, Mydans Journal of the American Chemical Society, 1932 , vol. 54, p. 4667,4673 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-hydroxy-1,2,3-triphenyl-pentan-1-one |