[(3,4,5-trimethoxyphenoxy)methyl]oxirane structure
|
Common Name | [(3,4,5-trimethoxyphenoxy)methyl]oxirane | ||
|---|---|---|---|---|
| CAS Number | 74760-14-8 | Molecular Weight | 240.25200 | |
| Density | 1.167g/cm3 | Boiling Point | 351.9ºC at 760 mmHg | |
| Molecular Formula | C12H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.9ºC | |
| Name | 2-[(3,4,5-trimethoxyphenoxy)methyl]oxirane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 351.9ºC at 760 mmHg |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25200 |
| Flash Point | 145.9ºC |
| Exact Mass | 240.10000 |
| PSA | 49.45000 |
| LogP | 1.49000 |
| Index of Refraction | 1.512 |
| InChIKey | DMPSZPVEKHHIBR-UHFFFAOYSA-N |
| SMILES | COc1cc(OCC2CO2)cc(OC)c1OC |
| HS Code | 2910900090 |
|---|
|
~87%
[(3,4,5-trimeth... CAS#:74760-14-8 |
| Literature: Narsaiah, A. Venkat; Nagaiah Synthesis, 2010 , # 16 art. no. Z07610SS, p. 2705 - 2707 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2910900090 |
|---|---|
| Summary | 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| einecs 277-990-8 |