(E)-4-(4-bromophenyl)-4-oxo-but-2-enoyl chloride structure
|
Common Name | (E)-4-(4-bromophenyl)-4-oxo-but-2-enoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 7477-66-9 | Molecular Weight | 273.51000 | |
| Density | 1.587g/cm3 | Boiling Point | 354.1ºC at 760 mmHg | |
| Molecular Formula | C10H6BrClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168ºC | |
| Name | 4-(4-bromophenyl)-4-oxobut-2-enoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.587g/cm3 |
|---|---|
| Boiling Point | 354.1ºC at 760 mmHg |
| Molecular Formula | C10H6BrClO2 |
| Molecular Weight | 273.51000 |
| Flash Point | 168ºC |
| Exact Mass | 271.92400 |
| PSA | 34.14000 |
| LogP | 2.95340 |
| Index of Refraction | 1.59 |
| InChIKey | CKHMRUPKNSXZIQ-AATRIKPKSA-N |
| SMILES | O=C(Cl)C=CC(=O)c1ccc(Br)cc1 |
|
~%
(E)-4-(4-bromop... CAS#:7477-66-9 |
| Literature: Kohler, Woodward Journal of the American Chemical Society, 1936 , vol. 58, p. 1933,1935 |
|
~%
(E)-4-(4-bromop... CAS#:7477-66-9 |
| Literature: Lutz; Scott Journal of Organic Chemistry, 1948 , vol. 13, p. 284,292 |
| trans-4-Brombenzoyl-acrylchlorid |