3-(4-BROMOBENZOYL)PROPIONIC ACID structure
|
Common Name | 3-(4-BROMOBENZOYL)PROPIONIC ACID | ||
|---|---|---|---|---|
| CAS Number | 6340-79-0 | Molecular Weight | 257.08100 | |
| Density | 1.56 g/cm3 | Boiling Point | 428ºC at 760 mmHg | |
| Molecular Formula | C10H9BrO3 | Melting Point | 148-152 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 212.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-(4-Bromobenzoyl)propionic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56 g/cm3 |
|---|---|
| Boiling Point | 428ºC at 760 mmHg |
| Melting Point | 148-152 °C(lit.) |
| Molecular Formula | C10H9BrO3 |
| Molecular Weight | 257.08100 |
| Flash Point | 212.6ºC |
| Exact Mass | 255.97400 |
| PSA | 54.37000 |
| LogP | 2.49660 |
| InChIKey | ZODFRCZNTXLDDW-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)c1ccc(Br)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
An alternative route to syntheses of aryl keto acids in a chloroaluminate ionic liquid. Mohile SS, et al.
J. Chem. Res. (M) 10 , 650-651, (2003)
|
| EINECS 228-732-8 |
| MFCD00016563 |
| 4-(4-bromophenyl)-4-oxobutanoic acid |