Pyrazinium, 1-(2-oxo-2-phenylethyl)-, bromide (1:1) structure
|
Common Name | Pyrazinium, 1-(2-oxo-2-phenylethyl)-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 7477-71-6 | Molecular Weight | 279.13300 | |
| Density | 1.13g/cm3 | Boiling Point | 345.3ºC at 760mmHg | |
| Molecular Formula | C12H11BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.6ºC | |
| Name | 1-phenyl-2-pyrazin-1-ium-1-ylethanone,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 345.3ºC at 760mmHg |
| Molecular Formula | C12H11BrN2O |
| Molecular Weight | 279.13300 |
| Flash Point | 162.6ºC |
| Exact Mass | 278.00500 |
| PSA | 33.84000 |
| Index of Refraction | 1.578 |
| InChIKey | LATAPHUANPKTTI-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1ccncc1)c1ccccc1.[Br-] |
|
~%
Pyrazinium, 1-(... CAS#:7477-71-6 |
| Literature: Bahner; Norton Journal of the American Chemical Society, 1950 , vol. 72, p. 2881 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HMS2844P21 |
| 1-PHENYL-2-PYRAZIN-1-IUM-1-YLETHANONE BROMIDE |
| 1-phenacyl-pyrazinium,bromide |