1,5-Diphenyltetrazole structure
|
Common Name | 1,5-Diphenyltetrazole | ||
|---|---|---|---|---|
| CAS Number | 7477-73-8 | Molecular Weight | 222.24500 | |
| Density | 1.22g/cm3 | Boiling Point | 406ºC at 760 mmHg | |
| Molecular Formula | C13H10N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.3ºC | |
| Name | 1,5-Diphenyltetrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 406ºC at 760 mmHg |
| Molecular Formula | C13H10N4 |
| Molecular Weight | 222.24500 |
| Flash Point | 199.3ºC |
| Exact Mass | 222.09100 |
| PSA | 43.60000 |
| LogP | 2.32930 |
| Index of Refraction | 1.672 |
| InChIKey | FCERNNLMTCOKHX-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2nnnn2-c2ccccc2)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Tetrazole,1,5-diphenyl |
| 1,5-Diphenyltetrazol |
| 1,5-Diphenyl-1H-tetrazol |
| 1H-Tetrazole,5-diphenyl |
| 1,5-diphenyl 1H-tetrazole |