(3-acetyl-2-benzoyloxy-6-methoxy-phenyl) benzoate structure
|
Common Name | (3-acetyl-2-benzoyloxy-6-methoxy-phenyl) benzoate | ||
|---|---|---|---|---|
| CAS Number | 7478-81-1 | Molecular Weight | 390.38500 | |
| Density | 1.252g/cm3 | Boiling Point | 599.4ºC at 760 mmHg | |
| Molecular Formula | C23H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.5ºC | |
| Name | (6-acetyl-2-benzoyloxy-3-methoxyphenyl) benzoate |
|---|
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 599.4ºC at 760 mmHg |
| Molecular Formula | C23H18O6 |
| Molecular Weight | 390.38500 |
| Flash Point | 261.5ºC |
| Exact Mass | 390.11000 |
| PSA | 78.90000 |
| LogP | 4.33620 |
| Index of Refraction | 1.597 |
| InChIKey | WJVLIHOOYQQCAE-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C)=O)c(OC(=O)c2ccccc2)c1OC(=O)c1ccccc1 |
|
~%
(3-acetyl-2-ben... CAS#:7478-81-1 |
| Literature: Ishwar-Dass et al. Proceedings - Indian Academy of Sciences, Section A, 1953 , # 37 p. 599,608 |
|
~%
(3-acetyl-2-ben... CAS#:7478-81-1 |
| Literature: Ishwar-Dass et al. Proceedings - Indian Academy of Sciences, Section A, 1953 , # 37 p. 599,608 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |