O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate
O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate structure
|
Common Name | O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate | ||
|---|---|---|---|---|
| CAS Number | 74875-14-2 | Molecular Weight | 295.14200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8Cl2N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8Cl2N2O3S |
|---|---|
| Molecular Weight | 295.14200 |
| Exact Mass | 293.96300 |
| PSA | 90.38000 |
| LogP | 3.65010 |
| InChIKey | LGLZFHKCTJYNCK-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)Oc1c(Cl)cc([N+](=O)[O-])cc1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~75%
O-(2,6-dichloro... CAS#:74875-14-2 |
| Literature: F. HOFFMANN-LA ROCHE AG Patent: WO2007/9913 A1, 2007 ; Location in patent: Page/Page column 126-127 ; WO 2007/009913 A1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:74875-15-3This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate? |
| A: SMILES notation of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate is CN(C)C(=S)Oc1c(Cl)cc([N+](=O)[O-])cc1Cl. |
| Q: What is the CAS number of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate? |
| A: CAS number of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate is 74875-14-2. |
| Q: What is the English name of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate? |
| A: The English name of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate is O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate. |
| Q: What are the upstream materials of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate? |
| A: Related upstream materials(CAS) of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate: 618-80-4;16420-13-6. |
| Q: What is the molecular weight of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate? |
| A: Molecular weight of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate is 295.14200. |
| Q: What is the polar surface area (PSA) of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate? |
| A: Polar surface area (PSA) of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate is 90.38000. |
| Q: What are the downstream products of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate? |
| A: Related downstream products(CAS) of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate: 74875-15-3. |
| Q: What is the LogP of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate? |
| A: LogP of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate is 3.65010. |
| Q: What is the InChIKey of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate? |
| A: InChIKey of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate is LGLZFHKCTJYNCK-UHFFFAOYSA-N. |
| Q: What is the molecular formula of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate? |
| A: Molecular formula of O-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate is C9H8Cl2N2O3S. |