RU28362 structure
|
Common Name | RU28362 | ||
|---|---|---|---|---|
| CAS Number | 74915-64-3 | Molecular Weight | 352.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RU28362RU28362 is a potent and selective glucocorticoid agonist. RU28362 increases the Bnip3 mRNA levels in neurons. RU28362 inhibits adrenocorticotrophic hormone (ACTH) and corticosterone secretion[1][2]. |
| Name | ru 28362 |
|---|---|
| Synonym | More Synonyms |
| Description | RU28362 is a potent and selective glucocorticoid agonist. RU28362 increases the Bnip3 mRNA levels in neurons. RU28362 inhibits adrenocorticotrophic hormone (ACTH) and corticosterone secretion[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H28O3 |
|---|---|
| Molecular Weight | 352.47 |
| Exact Mass | 352.20400 |
| PSA | 57.53000 |
| LogP | 3.18560 |
| InChIKey | UFZKDKHLKHEFGA-ZFTCBNFESA-N |
| SMILES | CC#CC1(O)CCC2C3C=C(C)C4=CC(=O)C=CC4(C)C3C(O)CC21C |
| 11β,17β-dihydroxy-6,21-dimethyl-17α-pregna-1,4,6-trien-20-yn-3-one |
| RU28362 |
| (11BETA,17BETA)-11,17-DIHYDROXY-6-METHYL-17-(1-PROPYNYL)-ANDROSTA-1,4,6-TRIEN-3-ONE |