2-ethoxy-3-nitro-1,5-naphthyridine structure
|
Common Name | 2-ethoxy-3-nitro-1,5-naphthyridine | ||
|---|---|---|---|---|
| CAS Number | 74919-32-7 | Molecular Weight | 219.19700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethoxy-3-nitro-1,5-naphthyridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9N3O3 |
|---|---|
| Molecular Weight | 219.19700 |
| Exact Mass | 219.06400 |
| PSA | 80.83000 |
| LogP | 2.45990 |
| InChIKey | ATJXHCKEPZVXGM-UHFFFAOYSA-N |
| SMILES | CCOc1nc2cccnc2cc1[N+](=O)[O-] |
|
~%
2-ethoxy-3-nitr... CAS#:74919-32-7 |
| Literature: Haak, H. J. W. van den; Plas, H. C. van der Recueil: Journal of the Royal Netherlands Chemical Society, 1980 , vol. 99, # 3 p. 83 - 86 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Ethoxy-3-nitro-naphtyridin-1,5 |
| 1,5-Naphthyridine,2-ethoxy-3-nitro |