2-chloro-3-nitro-1,5-naphthyridine structure
|
Common Name | 2-chloro-3-nitro-1,5-naphthyridine | ||
|---|---|---|---|---|
| CAS Number | 74919-33-8 | Molecular Weight | 209.58900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-3-nitro-1,5-naphthyridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H4ClN3O2 |
|---|---|
| Molecular Weight | 209.58900 |
| Exact Mass | 208.99900 |
| PSA | 71.60000 |
| LogP | 2.71460 |
| InChIKey | SFKCHWCGYMDITM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2ncccc2nc1Cl |
|
~59%
2-chloro-3-nitr... CAS#:74919-33-8 |
| Literature: Wozniak, M.; Plas, H. C. van der; Tomula, M.; Veldhuizen, A. van Recueil: Journal of the Royal Netherlands Chemical Society, 1983 , vol. 102, p. 511 - 513 |
| 1,5-Naphthyridine,2-chloro-3-nitro |