2-(thiophene-2-carbonyl)naphthalene-1-carboxylic acid structure
|
Common Name | 2-(thiophene-2-carbonyl)naphthalene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 7495-40-1 | Molecular Weight | 282.31400 | |
| Density | 1.386g/cm3 | Boiling Point | 545.1ºC at 760 mmHg | |
| Molecular Formula | C16H10O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.5ºC | |
| Name | 2-(thiophene-2-carbonyl)naphthalene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 545.1ºC at 760 mmHg |
| Molecular Formula | C16H10O3S |
| Molecular Weight | 282.31400 |
| Flash Point | 283.5ºC |
| Exact Mass | 282.03500 |
| PSA | 82.61000 |
| LogP | 3.83050 |
| Index of Refraction | 1.705 |
| InChIKey | KHJKUDICESMHQA-UHFFFAOYSA-N |
| SMILES | O=C(c1cccs1)c1ccc2ccccc2c1C(=O)O |
|
~%
2-(thiophene-2-... CAS#:7495-40-1 |
| Literature: Newman; Ihrman Journal of the American Chemical Society, 1958 , vol. 80, p. 3652,3656 |
|
~%
2-(thiophene-2-... CAS#:7495-40-1 |
| Literature: Sandin; Fieser Journal of the American Chemical Society, 1940 , vol. 62, p. 3098,3103 |
| 2-(thiophene-2-carbonyl)-[1]naphthoic acid |
| 2-(Thiophen-2-carbonyl)-[1]naphthoesaeure |
| 2-(2-Thienoyl)-naphthoesaeure-1 |
| 2-(thiophene-2-carbonyl)-naphthalene-1-carboxylic acid |