Chrysene, 6-nitro- structure
|
Common Name | Chrysene, 6-nitro- | ||
|---|---|---|---|---|
| CAS Number | 7496-02-8 | Molecular Weight | 273.28500 | |
| Density | 1.342g/cm3 | Boiling Point | 505ºC at 760 mmHg | |
| Molecular Formula | C18H11NO2 | Melting Point | 220ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 252.5ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | 6-Nitrochrysene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342g/cm3 |
|---|---|
| Boiling Point | 505ºC at 760 mmHg |
| Melting Point | 220ºC (dec.)(lit.) |
| Molecular Formula | C18H11NO2 |
| Molecular Weight | 273.28500 |
| Flash Point | 252.5ºC |
| Exact Mass | 273.07900 |
| PSA | 45.82000 |
| LogP | 5.57760 |
| Index of Refraction | 1.791 |
| InChIKey | UAWLTQJFZUYROA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2c3ccccc3ccc2c2ccccc12 |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302 + H312 + H332-H340-H350 |
| Precautionary Statements | P201-P261-P280-P301 + P312 + P330-P308 + P313 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | 45-46-20/21/22 |
| Safety Phrases | S22;S45;S53;S36/S37/S39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | GC1930000 |
|
Polycyclic nitroarenes (nitro-PAHs) as biomarkers of exposure to diesel exhaust.
Mutat. Res. 441(1) , 135-44, (1999) Diesel exhaust contains numerous genotoxic carcinogens. It is essentially unknown to which extent this source contributes to the total load of these chemicals in humans. One possible approach to the p... |
|
|
Synthesis of anti-1,2-dihydroxy-3,4-epoxy-1,2,3, 4-tetrahydro-6-nitrochrysene and its reaction with 2'-deoxyguanosine- 5'-monophosphate, 2'-deoxyadenosine-5'-monophosphate, and calf thymus DNA in vitro.
Chem. Res. Toxicol. 13(11) , 1143-8, (2000) The remarkable carcinogenic activity of 6-nitrochrysene (6-NC) in several animal models, and its environmental presence, suggest its potential importance with regard to human cancer development. Depen... |
|
|
Genomic DNA sequencing of mRNA splicing mutants in the hprt gene of Chinese hamster ovary cells.
Environ. Mol. Mutagen. 25(2) , 85-96, (1995) We have analyzed 41 mRNA-splicing mutants from the hypoxanthine-guanine phosphoribosyl-transferase (hprt) gene of Chinese hamster ovary (CHO) cells. Twenty-two of these mutants produced single cDNA PC... |
| 6-nitrochrysene |
| MFCD00021179 |