4-chloro-4'-nitrobenzophenone structure
|
Common Name | 4-chloro-4'-nitrobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 7497-60-1 | Molecular Weight | 261.66100 | |
| Density | 1.367 g/cm3 | Boiling Point | 425.9ºC at 760 mmHg | |
| Molecular Formula | C13H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.4ºC | |
| Name | (4-chlorophenyl)-(4-nitrophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367 g/cm3 |
|---|---|
| Boiling Point | 425.9ºC at 760 mmHg |
| Molecular Formula | C13H8ClNO3 |
| Molecular Weight | 261.66100 |
| Flash Point | 211.4ºC |
| Exact Mass | 261.01900 |
| PSA | 62.89000 |
| LogP | 4.00240 |
| Index of Refraction | 1.623 |
| InChIKey | CLFRUWPJQKSRRT-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccc([N+](=O)[O-])cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Chloro-4'-nitrobenzophenone |
| 4'-nitro-4-chlorobenzophenone |
| MFCD00047743 |