1(4H)-Naphthalenone,4-(dichloromethyl)-4-methyl- structure
|
Common Name | 1(4H)-Naphthalenone,4-(dichloromethyl)-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 7499-74-3 | Molecular Weight | 241.11300 | |
| Density | 1.293g/cm3 | Boiling Point | 359.6ºC at 760mmHg | |
| Molecular Formula | C12H10Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.9ºC | |
| Name | 4-(dichloromethyl)-4-methylnaphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.293g/cm3 |
|---|---|
| Boiling Point | 359.6ºC at 760mmHg |
| Molecular Formula | C12H10Cl2O |
| Molecular Weight | 241.11300 |
| Flash Point | 151.9ºC |
| Exact Mass | 240.01100 |
| PSA | 17.07000 |
| LogP | 3.50050 |
| Index of Refraction | 1.576 |
| InChIKey | CTNFCHNIMSCIBV-UHFFFAOYSA-N |
| SMILES | CC1(C(Cl)Cl)C=CC(=O)c2ccccc21 |
|
~%
1(4H)-Naphthale... CAS#:7499-74-3 |
| Literature: Fuson; Miller Journal of Organic Chemistry, 1952 , vol. 17, p. 316,318 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Methyl-4-dichlormethyl-1(4H)-naphthalon |
| 4-dichloromethyl-4-methyl-4H-naphthalen-1-one |
| 4-Dichlormethyl-4-methyl-4H-naphthalin-1-on |
| 4-Oxo-1-methyl-1-dichlormethyl-1.4-dihydro-naphthalin |