1H-Indole,3,3'-[(4-nitrophenyl)methylene]bis
![1H-Indole,3,3'-[(4-nitrophenyl)methylene]bis Structure](https://image.chemsrc.com/caspic/286/7501-91-9.png)
1H-Indole,3,3'-[(4-nitrophenyl)methylene]bis structure
|
Common Name | 1H-Indole,3,3'-[(4-nitrophenyl)methylene]bis | ||
|---|---|---|---|---|
| CAS Number | 7501-91-9 | Molecular Weight | 367.40000 | |
| Density | 1.363g/cm3 | Boiling Point | 633.2ºC at 760mmHg | |
| Molecular Formula | C23H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.363g/cm3 |
|---|---|
| Boiling Point | 633.2ºC at 760mmHg |
| Molecular Formula | C23H17N3O2 |
| Molecular Weight | 367.40000 |
| Flash Point | 336.8ºC |
| Exact Mass | 367.13200 |
| PSA | 77.40000 |
| LogP | 6.26080 |
| Index of Refraction | 1.761 |
| InChIKey | OESZGFYDUDJFLN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(c2c[nH]c3ccccc23)c2c[nH]c3ccccc23)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
CAS#:120-72-9
CAS#:555-16-8![Benzenamine,N-[(4-nitrophenyl)methylene] Structure](https://image.chemsrc.com/caspic/320/785-80-8.png)
CAS#:785-80-8![4-methyl-N-[(4-nitrophenyl)methylidene]benzenesulfonamide Structure](https://image.chemsrc.com/caspic/315/13707-46-5.png)
CAS#:13707-46-5
CAS#:1614-00-2
CAS#:1624-47-1
CAS#:263386-39-6
CAS#:881-67-4
CAS#:619-73-8This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole? |
| A: Molecular formula of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole is C23H17N3O2. |
| Q: What is the CAS number of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole? |
| A: CAS number of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole is 7501-91-9. |
| Q: What is the SMILES notation of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole? |
| A: SMILES notation of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole is O=[N+]([O-])c1ccc(C(c2c[nH]c3ccccc23)c2c[nH]c3ccccc23)cc1. |
| Q: What is the boiling point of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole? |
| A: Boiling point of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole is 633.2ºC at 760mmHg. |
| Q: What is the polar surface area (PSA) of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole? |
| A: Polar surface area (PSA) of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole is 77.40000. |
| Q: What is the InChIKey of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole? |
| A: InChIKey of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole is OESZGFYDUDJFLN-UHFFFAOYSA-N. |
| Q: What is the English name of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole? |
| A: The English name of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole is 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole. |
| Q: What is the molecular weight of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole? |
| A: Molecular weight of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole is 367.40000. |
| Q: What is the LogP of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole? |
| A: LogP of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole is 6.26080. |
| Q: What are the upstream materials of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole? |
| A: Related upstream materials(CAS) of 3-[1H-indol-3-yl-(4-nitrophenyl)methyl]-1H-indole: 120-72-9;555-16-8;785-80-8;13707-46-5;1614-00-2;1624-47-1;263386-39-6;881-67-4;619-73-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |