1-phenyl-3-[(E)-1-pyridin-2-ylethylideneamino]urea structure
|
Common Name | 1-phenyl-3-[(E)-1-pyridin-2-ylethylideneamino]urea | ||
|---|---|---|---|---|
| CAS Number | 75013-85-3 | Molecular Weight | 254.28700 | |
| Density | 1.176g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenyl-3-[(E)-1-pyridin-2-ylethylideneamino]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.28700 |
| Exact Mass | 254.11700 |
| PSA | 69.87000 |
| LogP | 3.03180 |
| Index of Refraction | 1.609 |
| InChIKey | IZBUGIQWTMEWSL-GZTJUZNOSA-N |
| SMILES | CC(=NNC(=O)Nc1ccccc1)c1ccccn1 |
|
~65%
1-phenyl-3-[(E)... CAS#:75013-85-3 |
| Literature: Nfor, Emmanuel N.; Esemu, Seraphine N.; Ayimele, Godfred A.; Eno, Ededet A.; Iniama, Grace E.; Offiong, Offiong E. Bulletin of the Chemical Society of Ethiopia, 2011 , vol. 25, # 3 p. 361 - 370 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ketone,methyl 2-pyridyl,4-phenylsemicarbazone |
| methyl pyridin-2-yl ketone 4-phenylsemicarbazone |