2,4-Imidazolidinedione,5-[1,1'-biphenyl]-4-yl-5-methyl- structure
|
Common Name | 2,4-Imidazolidinedione,5-[1,1'-biphenyl]-4-yl-5-methyl- | ||
|---|---|---|---|---|
| CAS Number | 7502-05-8 | Molecular Weight | 266.29500 | |
| Density | 1.201g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-5-(4-phenylphenyl)imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.29500 |
| Exact Mass | 266.10600 |
| PSA | 58.20000 |
| LogP | 3.06580 |
| Index of Refraction | 1.586 |
| InChIKey | IDNUJSHPIFGVCQ-UHFFFAOYSA-N |
| SMILES | CC1(c2ccc(-c3ccccc3)cc2)NC(=O)NC1=O |
|
~%
2,4-Imidazolidi... CAS#:7502-05-8 |
| Literature: Henze; Long Journal of the American Chemical Society, 1941 , vol. 63, p. 1941 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-(1,1'-BIPHENYL-4-YL)-5-METHYLIMIDAZOLIDINE-2,4-DIONE |
| 5-biphenyl-4-yl-5-methyl-imidazolidine-2,4-dione |
| 5-Biphenyl-4-yl-5-methyl-imidazolidin-2,4-dion |
| 5-(4-biphenylyl)-5-methylimidazolidine-2,4-dione |