3-methoxy-7-methyl-3-(2-methylphenyl)isobenzofuran-1-one structure
|
Common Name | 3-methoxy-7-methyl-3-(2-methylphenyl)isobenzofuran-1-one | ||
|---|---|---|---|---|
| CAS Number | 7504-12-3 | Molecular Weight | 268.30700 | |
| Density | 1.2g/cm3 | Boiling Point | 432.2ºC at 760 mmHg | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.3ºC | |
| Name | 3-methoxy-7-methyl-3-(2-methylphenyl)-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 432.2ºC at 760 mmHg |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.30700 |
| Flash Point | 184.3ºC |
| Exact Mass | 268.11000 |
| PSA | 35.53000 |
| LogP | 3.32130 |
| Index of Refraction | 1.602 |
| InChIKey | VVJPTHRFLICXKG-UHFFFAOYSA-N |
| SMILES | COC1(c2ccccc2C)OC(=O)c2c(C)cccc21 |
|
~%
3-methoxy-7-met... CAS#:7504-12-3 |
| Literature: Newman; McCleary Journal of the American Chemical Society, 1941 , vol. 63, p. 1537,1540 |
|
~%
3-methoxy-7-met... CAS#:7504-12-3 |
| Literature: Newman; McCleary Journal of the American Chemical Society, 1941 , vol. 63, p. 1537,1540 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-methoxy-7-methyl-3-o-tolyl-phthalide |