2-[3-(2-nitrophenyl)prop-2-enyl]isoindole-1,3-dione
Modify Date: 2024-04-03 10:01:57
![2-[3-(2-nitrophenyl)prop-2-enyl]isoindole-1,3-dione Structure](https://image.chemsrc.com/caspic/066/75059-03-9.png)
2-[3-(2-nitrophenyl)prop-2-enyl]isoindole-1,3-dione structure
|
Common Name | 2-[3-(2-nitrophenyl)prop-2-enyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 75059-03-9 | Molecular Weight | 308.28800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[3-(2-nitrophenyl)prop-2-enyl]isoindole-1,3-dione |
|---|
| Molecular Formula | C17H12N2O4 |
|---|---|
| Molecular Weight | 308.28800 |
| Exact Mass | 308.08000 |
| PSA | 83.20000 |
| LogP | 3.36530 |
| InChIKey | JGLDMQGSJVSJOV-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CC=Cc1ccccc1[N+](=O)[O-] |
|
~73%
2-[3-(2-nitroph... CAS#:75059-03-9 |
| Literature: Moody, Christopher J.; Rahimtoola, Kulsum F.; Porter, Barry; Ross, Barry C. Journal of Organic Chemistry, 1992 , vol. 57, # 7 p. 2105 - 2114 |
|
~%
2-[3-(2-nitroph... CAS#:75059-03-9 |
| Literature: Moody, Christopher J.; Rahimtoola, Kulsum F.; Porter, Barry; Ross, Barry C. Journal of Organic Chemistry, 1992 , vol. 57, # 7 p. 2105 - 2114 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:85753-43-1