3,4-dichloro-N,N-diethyl-benzamide structure
|
Common Name | 3,4-dichloro-N,N-diethyl-benzamide | ||
|---|---|---|---|---|
| CAS Number | 7506-97-0 | Molecular Weight | 246.13300 | |
| Density | 1.22g/cm3 | Boiling Point | 374.1ºC at 760 mmHg | |
| Molecular Formula | C11H13Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180ºC | |
| Name | 3,4-dichloro-N,N-diethylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 374.1ºC at 760 mmHg |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.13300 |
| Flash Point | 180ºC |
| Exact Mass | 245.03700 |
| PSA | 20.31000 |
| LogP | 3.47540 |
| Index of Refraction | 1.544 |
| InChIKey | JSZUNEIMRSODOA-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)c1ccc(Cl)c(Cl)c1 |
|
~%
3,4-dichloro-N,... CAS#:7506-97-0 |
| Literature: McCabe et al. Journal of Organic Chemistry, 1954 , vol. 19, p. 493,496 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,4-dichloro-benzoic acid diethylamide |
| 3,4-Dichlor-benzoesaeure-diaethylamid |
| 3.4-Dichlorbenzoesaeure-diethylamid |
| 3,4-Dichloro-N,N-diethyl-benzamide |