Propanedioic acid,2-[3-(2-methylphenyl)propyl]- structure
|
Common Name | Propanedioic acid,2-[3-(2-methylphenyl)propyl]- | ||
|---|---|---|---|---|
| CAS Number | 7508-14-7 | Molecular Weight | 236.26400 | |
| Density | 1.216g/cm3 | Boiling Point | 467.9ºC at 760 mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.9ºC | |
| Name | 2-[3-(2-methylphenyl)propyl]propanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 467.9ºC at 760 mmHg |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Flash Point | 250.9ºC |
| Exact Mass | 236.10500 |
| PSA | 74.60000 |
| LogP | 2.10310 |
| Index of Refraction | 1.554 |
| InChIKey | HHLGHPPSEJBLIB-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1CCCC(C(=O)O)C(=O)O |
|
~%
Propanedioic ac... CAS#:7508-14-7 |
| Literature: Anderson et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 598,600 |
|
~%
Propanedioic ac... CAS#:7508-14-7 |
| Literature: Anderson et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 598,600 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (3-o-Tolyl-propyl)-malonsaeure |
| (3-o-tolyl-propyl)-malonic acid |