1,2-bis(3-methoxy-4-prop-2-enoxy-phenyl)ethane-1,2-dione structure
|
Common Name | 1,2-bis(3-methoxy-4-prop-2-enoxy-phenyl)ethane-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 7508-46-5 | Molecular Weight | 382.40600 | |
| Density | 1.149g/cm3 | Boiling Point | 541.1ºC at 760 mmHg | |
| Molecular Formula | C22H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.4ºC | |
| Name | 1,2-bis(3-methoxy-4-prop-2-enoxyphenyl)ethane-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.149g/cm3 |
|---|---|
| Boiling Point | 541.1ºC at 760 mmHg |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.40600 |
| Flash Point | 235.4ºC |
| Exact Mass | 382.14200 |
| PSA | 71.06000 |
| LogP | 3.89900 |
| Index of Refraction | 1.549 |
| InChIKey | ZXGGWEQQNHLJLJ-UHFFFAOYSA-N |
| SMILES | C=CCOc1ccc(C(=O)C(=O)c2ccc(OCC=C)c(OC)c2)cc1OC |
|
~%
1,2-bis(3-metho... CAS#:7508-46-5 |
| Literature: Pearl Journal of the American Chemical Society, 1955 , vol. 77, p. 2826 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4'-Bis-allyloxy-3,3'-dimethoxy-benzil |