3-chloro-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,6-triene-5-thione structure
|
Common Name | 3-chloro-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,6-triene-5-thione | ||
|---|---|---|---|---|
| CAS Number | 7508-59-0 | Molecular Weight | 186.62200 | |
| Density | 2.01g/cm3 | Boiling Point | 313.4ºC at 760 mmHg | |
| Molecular Formula | C5H3ClN4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.4ºC | |
| Name | 6-chloro-1,2-dihydropyrazolo[3,4-d]pyrimidine-4-thione |
|---|
| Density | 2.01g/cm3 |
|---|---|
| Boiling Point | 313.4ºC at 760 mmHg |
| Molecular Formula | C5H3ClN4S |
| Molecular Weight | 186.62200 |
| Flash Point | 143.4ºC |
| Exact Mass | 185.97700 |
| PSA | 89.45000 |
| LogP | 1.66890 |
| Index of Refraction | 1.944 |
| InChIKey | YYECQADENGBYLX-UHFFFAOYSA-N |
| SMILES | S=c1nc(Cl)[nH]c2[nH]ncc12 |
|
~%
3-chloro-2,4,8,... CAS#:7508-59-0 |
| Literature: Robins Journal of the American Chemical Society, 1957 , vol. 79, p. 6407,6412 |
|
~%
3-chloro-2,4,8,... CAS#:7508-59-0 |
| Literature: Robins Journal of the American Chemical Society, 1957 , vol. 79, p. 6407,6412 |