Benzoic acid, 4- (phenylazo)-, ethyl ester structure
|
Common Name | Benzoic acid, 4- (phenylazo)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7508-68-1 | Molecular Weight | 254.28400 | |
| Density | 1.1g/cm3 | Boiling Point | 394.4ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.4ºC | |
| Name | ethyl 4-phenyldiazenylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 394.4ºC at 760 mmHg |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.28400 |
| Flash Point | 174.4ºC |
| Exact Mass | 254.10600 |
| PSA | 51.02000 |
| LogP | 4.27870 |
| Index of Refraction | 1.565 |
| InChIKey | ZABJMLAHGWTODF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N=Nc2ccccc2)cc1 |
|
~%
Benzoic acid, 4... CAS#:7508-68-1 |
| Literature: Applequist,D.E.; McGreer,D.E. Journal of the American Chemical Society, 1960 , vol. 82, p. 1965 - 1972 |
|
~%
Benzoic acid, 4... CAS#:7508-68-1 |
| Literature: Wieland Chemische Berichte, 1915 , vol. 48, p. 1110 |
|
~%
Benzoic acid, 4... CAS#:7508-68-1 |
| Literature: Wieland Chemische Berichte, 1915 , vol. 48, p. 1110 |
| Benzoic acid,4-(phenylazo)-,ethyl ester |
| 4-phenylazo-benzoic acid ethyl ester |
| 4-Phenylazo-benzoesaeure-aethylester |
| 4-Ethoxycarbonyl-azobenzol |
| Azobenzol-carbonsaeure-(4)-ethylester |
| Benzoic acid,p-(phenylazo)-,ethyl ester |
| Azobenzol-carbonsaeure-(4)-aethylester |
| 4-Aethoxycarbonyl-azobenzol |
| p-Phenylazo-benzoesaeure-aethylester |
| Ethyl 4-(phenylazo)benzoate |