Phosphoric acid,4-methoxy-2,5-dimethylphenyl dimethyl ester structure
|
Common Name | Phosphoric acid,4-methoxy-2,5-dimethylphenyl dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7509-05-9 | Molecular Weight | 260.22300 | |
| Density | 1.164g/cm3 | Boiling Point | 314ºC at 760 mmHg | |
| Molecular Formula | C11H17O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.5ºC | |
| Name | (4-methoxy-2,5-dimethylphenyl) dimethyl phosphate |
|---|
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 314ºC at 760 mmHg |
| Molecular Formula | C11H17O5P |
| Molecular Weight | 260.22300 |
| Flash Point | 157.5ºC |
| Exact Mass | 260.08100 |
| PSA | 63.80000 |
| LogP | 3.09170 |
| Index of Refraction | 1.487 |
| InChIKey | DXLSMTYUCCIELG-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c(OP(=O)(OC)OC)cc1C |
|
~%
Phosphoric acid... CAS#:7509-05-9 |
| Literature: Ramirez et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 4338,4341 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |