4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethyl-aniline
![4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethyl-aniline Structure](https://image.chemsrc.com/caspic/206/75159-08-9.png)
4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethyl-aniline structure
|
Common Name | 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 75159-08-9 | Molecular Weight | 325.40600 | |
| Density | 1.11g/cm3 | Boiling Point | 539.4ºC at 760 mmHg | |
| Molecular Formula | C22H19N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 539.4ºC at 760 mmHg |
| Molecular Formula | C22H19N3 |
| Molecular Weight | 325.40600 |
| Flash Point | 280ºC |
| Exact Mass | 325.15800 |
| PSA | 27.96000 |
| LogP | 4.60450 |
| Index of Refraction | 1.629 |
| InChIKey | KZEORMYXLDOYGK-HZHRSRAPSA-N |
| SMILES | CN(C)c1ccc(C=NN=C2c3ccccc3-c3ccccc32)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~34%
4-[(fluoren-9-y... CAS#:75159-08-9 |
| Literature: Saito, Takao; Oikawa, Isao; Motoki, Shinichi Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 4 p. 1023 - 1027 |
![Benzaldehyde,4-(dimethylamino)-, 2-[[4-(dimethylamino)phenyl]methylene]hydrazone structure](https://image.chemsrc.com/caspic/217/2143-98-8.png)
![N-[(1E)-[4-(dimethylamino)phenyl]methylidene]-4-methylbenzene-1-sulfonamide structure](https://www.chemsrc.com/extcaspic/273/14674-40-9.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline? |
| A: LogP of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline is 4.60450. |
| Q: What is the boiling point of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline? |
| A: Boiling point of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline is 539.4ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline? |
| A: Polar surface area (PSA) of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline is 27.96000. |
| Q: What is the molecular weight of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline? |
| A: Molecular weight of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline is 325.40600. |
| Q: What is the English name of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline? |
| A: The English name of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline is 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline. |
| Q: What are the upstream materials of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline? |
| A: Related upstream materials(CAS) of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline: 63609-88-1;2143-98-8. |
| Q: What is the molecular formula of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline? |
| A: Molecular formula of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline is C22H19N3. |
| Q: What is the CAS number of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline? |
| A: CAS number of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline is 75159-08-9. |
| Q: What is the SMILES notation of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline? |
| A: SMILES notation of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline is CN(C)c1ccc(C=NN=C2c3ccccc3-c3ccccc32)cc1. |
| Q: What is the InChIKey of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline? |
| A: InChIKey of 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline is KZEORMYXLDOYGK-HZHRSRAPSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |