4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethyl-aniline structure
|
Common Name | 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 75159-08-9 | Molecular Weight | 325.40600 | |
| Density | 1.11g/cm3 | Boiling Point | 539.4ºC at 760 mmHg | |
| Molecular Formula | C22H19N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280ºC | |
| Name | 4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethylaniline |
|---|
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 539.4ºC at 760 mmHg |
| Molecular Formula | C22H19N3 |
| Molecular Weight | 325.40600 |
| Flash Point | 280ºC |
| Exact Mass | 325.15800 |
| PSA | 27.96000 |
| LogP | 4.60450 |
| Index of Refraction | 1.629 |
| InChIKey | KZEORMYXLDOYGK-HZHRSRAPSA-N |
| SMILES | CN(C)c1ccc(C=NN=C2c3ccccc3-c3ccccc32)cc1 |
|
~34%
4-[(fluoren-9-y... CAS#:75159-08-9 |
| Literature: Saito, Takao; Oikawa, Isao; Motoki, Shinichi Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 4 p. 1023 - 1027 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |